C33H25N3O — CID 43853062
N-(1-naphthalen-1-ylethyl)-2,3-diphenylquinoxaline-6-carboxamide (PubChem CID 43853062) has the molecular formula C33H25N3O and a molecular weight of 479.58 g/mol. Its IUPAC name is N-(1-naphthalen-1-ylethyl)-2,3-diphenylquinoxaline-6-carboxamide.
| Compound Name | N-(1-naphthalen-1-ylethyl)-2,3-diphenylquinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 43853062 |
| Molecular Formula | C33H25N3O |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.20 |
| IUPAC Name | N-(1-naphthalen-1-ylethyl)-2,3-diphenylquinoxaline-6-carboxamide |
| SMILES | CC(NC(=O)c1ccc2nc(-c3ccccc3)c(-c3ccccc3)nc2c1)c1cccc2ccccc12 |
| InChI | InChI=1S/C33H25N3O/c1-22(27-18-10-16-23-11-8-9-17-28(23)27)34-33(37)26-19-20-29-30(21-26)36-32(25-14-6-3-7-15-25)31(35-29)24-12-4-2-5-13-24/h2-22H,1H3,(H,34,37) |
| InChIKey | QXZJFEBONYAVOO-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |