C22H19NO2 — CID 155963043
3-(3-hydroxyprop-1-ynyl)-N-(1-naphthalen-1-ylethyl)benzamide (PubChem CID 155963043) has the molecular formula C22H19NO2 and a molecular weight of 329.40 g/mol. Its IUPAC name is 3-(3-hydroxyprop-1-ynyl)-N-(1-naphthalen-1-ylethyl)benzamide.
| Compound Name | 3-(3-hydroxyprop-1-ynyl)-N-(1-naphthalen-1-ylethyl)benzamide |
|---|---|
| PubChem CID | 155963043 |
| Molecular Formula | C22H19NO2 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | 3-(3-hydroxyprop-1-ynyl)-N-(1-naphthalen-1-ylethyl)benzamide |
| SMILES | CC(NC(=O)c1cccc(C#CCO)c1)c1cccc2ccccc12 |
| InChI | InChI=1S/C22H19NO2/c1-16(20-13-5-10-18-9-2-3-12-21(18)20)23-22(25)19-11-4-7-17(15-19)8-6-14-24/h2-5,7,9-13,15-16,24H,14H2,1H3,(H,23,25) |
| InChIKey | PWJQHYMYEHGDLG-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|