C22H21NO — CID 59562837
3-[3-[[[(1R)-1-naphthalen-1-ylethyl]amino]methyl]phenyl]prop-2-yn-1-ol (PubChem CID 59562837) has the molecular formula C22H21NO and a molecular weight of 315.42 g/mol. Its IUPAC name is 3-[3-[[[(1R)-1-naphthalen-1-ylethyl]amino]methyl]phenyl]prop-2-yn-1-ol.
| Compound Name | 3-[3-[[[(1R)-1-naphthalen-1-ylethyl]amino]methyl]phenyl]prop-2-yn-1-ol |
|---|---|
| PubChem CID | 59562837 |
| Molecular Formula | C22H21NO |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | 3-[3-[[[(1R)-1-naphthalen-1-ylethyl]amino]methyl]phenyl]prop-2-yn-1-ol |
| SMILES | C[C@@H](NCc1cccc(C#CCO)c1)c1cccc2ccccc12 |
| InChI | InChI=1S/C22H21NO/c1-17(21-13-5-11-20-10-2-3-12-22(20)21)23-16-19-8-4-7-18(15-19)9-6-14-24/h2-5,7-8,10-13,15,17,23-24H,14,16H2,1H3/t17-/m1/s1 |
| InChIKey | KQPLJBXTEIMSFC-QGZVFWFLSA-N |
| XLogP | 4.03 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|