C24H27NSi — CID 59562929
(1R)-1-naphthalen-1-yl-N-[[3-(2-trimethylsilylethynyl)phenyl]methyl]ethanamine (PubChem CID 59562929) has the molecular formula C24H27NSi and a molecular weight of 357.57 g/mol. Its IUPAC name is (1R)-1-naphthalen-1-yl-N-[[3-(2-trimethylsilylethynyl)phenyl]methyl]ethanamine.
| Compound Name | (1R)-1-naphthalen-1-yl-N-[[3-(2-trimethylsilylethynyl)phenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 59562929 |
| Molecular Formula | C24H27NSi |
| Molecular Weight | 357.57 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | (1R)-1-naphthalen-1-yl-N-[[3-(2-trimethylsilylethynyl)phenyl]methyl]ethanamine |
| SMILES | C[C@@H](NCc1cccc(C#C[Si](C)(C)C)c1)c1cccc2ccccc12 |
| InChI | InChI=1S/C24H27NSi/c1-19(23-14-8-12-22-11-5-6-13-24(22)23)25-18-21-10-7-9-20(17-21)15-16-26(2,3)4/h5-14,17,19,25H,18H2,1-4H3/t19-/m1/s1 |
| InChIKey | SLUJXCONNDOJAC-LJQANCHMSA-N |
| XLogP | 5.92 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.57 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|