C20H21Cl2NO — CID 18357734
N-[(3-chloro-4-methoxyphenyl)methyl]-1-naphthalen-1-ylethanamine;hydrochloride (PubChem CID 18357734) has the molecular formula C20H21Cl2NO and a molecular weight of 362.30 g/mol. Its IUPAC name is N-[(3-chloro-4-methoxyphenyl)methyl]-1-naphthalen-1-ylethanamine;hydrochloride.
| Compound Name | N-[(3-chloro-4-methoxyphenyl)methyl]-1-naphthalen-1-ylethanamine;hydrochloride |
|---|---|
| PubChem CID | 18357734 |
| Molecular Formula | C20H21Cl2NO |
| Molecular Weight | 362.30 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | N-[(3-chloro-4-methoxyphenyl)methyl]-1-naphthalen-1-ylethanamine;hydrochloride |
| SMILES | COc1ccc(CNC(C)c2cccc3ccccc23)cc1Cl.Cl |
| InChI | InChI=1S/C20H20ClNO.ClH/c1-14(17-9-5-7-16-6-3-4-8-18(16)17)22-13-15-10-11-20(23-2)19(21)12-15;/h3-12,14,22H,13H2,1-2H3;1H |
| InChIKey | HMTUJIUTOMFXPW-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.30 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |