C21H23NO2 — CID 30624473
(1R)-N-[(2,4-dimethoxyphenyl)methyl]-1-naphthalen-1-ylethanamine (PubChem CID 30624473) has the molecular formula C21H23NO2 and a molecular weight of 321.42 g/mol. Its IUPAC name is (1R)-N-[(2,4-dimethoxyphenyl)methyl]-1-naphthalen-1-ylethanamine.
| Compound Name | (1R)-N-[(2,4-dimethoxyphenyl)methyl]-1-naphthalen-1-ylethanamine |
|---|---|
| PubChem CID | 30624473 |
| Molecular Formula | C21H23NO2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | (1R)-N-[(2,4-dimethoxyphenyl)methyl]-1-naphthalen-1-ylethanamine |
| SMILES | COc1ccc(CN[C@H](C)c2cccc3ccccc23)c(OC)c1 |
| InChI | InChI=1S/C21H23NO2/c1-15(19-10-6-8-16-7-4-5-9-20(16)19)22-14-17-11-12-18(23-2)13-21(17)24-3/h4-13,15,22H,14H2,1-3H3/t15-/m1/s1 |
| InChIKey | PNYXMFBAZQFVCE-OAHLLOKOSA-N |
| XLogP | 4.71 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |