C19H18IN — CID 68766120
N-[(2-iodophenyl)methyl]-1-naphthalen-1-ylethanamine (PubChem CID 68766120) has the molecular formula C19H18IN and a molecular weight of 387.26 g/mol. Its IUPAC name is N-[(2-iodophenyl)methyl]-1-naphthalen-1-ylethanamine.
| Compound Name | N-[(2-iodophenyl)methyl]-1-naphthalen-1-ylethanamine |
|---|---|
| PubChem CID | 68766120 |
| Molecular Formula | C19H18IN |
| Molecular Weight | 387.26 g/mol |
| Exact Mass | 387.05 |
| IUPAC Name | N-[(2-iodophenyl)methyl]-1-naphthalen-1-ylethanamine |
| SMILES | CC(NCc1ccccc1I)c1cccc2ccccc12 |
| InChI | InChI=1S/C19H18IN/c1-14(21-13-16-8-3-5-12-19(16)20)17-11-6-9-15-7-2-4-10-18(15)17/h2-12,14,21H,13H2,1H3 |
| InChIKey | VFSODMWJCYXVIO-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.26 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|