C27H28N2O — CID 71049454
2-[(1S)-1-[2-[[[(1S)-1-naphthalen-1-ylethyl]amino]methyl]anilino]ethyl]phenol (PubChem CID 71049454) has the molecular formula C27H28N2O and a molecular weight of 396.53 g/mol. Its IUPAC name is 2-[(1S)-1-[2-[[[(1S)-1-naphthalen-1-ylethyl]amino]methyl]anilino]ethyl]phenol.
| Compound Name | 2-[(1S)-1-[2-[[[(1S)-1-naphthalen-1-ylethyl]amino]methyl]anilino]ethyl]phenol |
|---|---|
| PubChem CID | 71049454 |
| Molecular Formula | C27H28N2O |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | 2-[(1S)-1-[2-[[[(1S)-1-naphthalen-1-ylethyl]amino]methyl]anilino]ethyl]phenol |
| SMILES | C[C@H](Nc1ccccc1CN[C@@H](C)c1cccc2ccccc12)c1ccccc1O |
| InChI | InChI=1S/C27H28N2O/c1-19(23-15-9-12-21-10-3-5-14-25(21)23)28-18-22-11-4-7-16-26(22)29-20(2)24-13-6-8-17-27(24)30/h3-17,19-20,28-30H,18H2,1-2H3/t19-,20-/m0/s1 |
| InChIKey | OZOYNHQNAUVUPF-PMACEKPBSA-N |
| XLogP | 6.57 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|