C15H19NO — CID 28714573
3-[[(1S)-1-naphthalen-1-ylethyl]amino]propan-1-ol (PubChem CID 28714573) has the molecular formula C15H19NO and a molecular weight of 229.32 g/mol. Its IUPAC name is 3-[[(1S)-1-naphthalen-1-ylethyl]amino]propan-1-ol.
| Compound Name | 3-[[(1S)-1-naphthalen-1-ylethyl]amino]propan-1-ol |
|---|---|
| PubChem CID | 28714573 |
| Molecular Formula | C15H19NO |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.15 |
| IUPAC Name | 3-[[(1S)-1-naphthalen-1-ylethyl]amino]propan-1-ol |
| SMILES | C[C@H](NCCCO)c1cccc2ccccc12 |
| InChI | InChI=1S/C15H19NO/c1-12(16-10-5-11-17)14-9-4-7-13-6-2-3-8-15(13)14/h2-4,6-9,12,16-17H,5,10-11H2,1H3/t12-/m0/s1 |
| InChIKey | RMMSNRVCAADUTQ-LBPRGKRZSA-N |
| XLogP | 2.87 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|