C21H22ClN — CID 54480749
3-(2-chlorophenyl)-N-[(1R)-1-naphthalen-1-ylethyl]propan-1-amine (PubChem CID 54480749) has the molecular formula C21H22ClN and a molecular weight of 323.87 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-N-[(1R)-1-naphthalen-1-ylethyl]propan-1-amine.
| Compound Name | 3-(2-chlorophenyl)-N-[(1R)-1-naphthalen-1-ylethyl]propan-1-amine |
|---|---|
| PubChem CID | 54480749 |
| Molecular Formula | C21H22ClN |
| Molecular Weight | 323.87 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | 3-(2-chlorophenyl)-N-[(1R)-1-naphthalen-1-ylethyl]propan-1-amine |
| SMILES | C[C@@H](NCCCc1ccccc1Cl)c1cccc2ccccc12 |
| InChI | InChI=1S/C21H22ClN/c1-16(19-13-6-10-17-8-2-4-12-20(17)19)23-15-7-11-18-9-3-5-14-21(18)22/h2-6,8-10,12-14,16,23H,7,11,15H2,1H3/t16-/m1/s1 |
| InChIKey | XOVFJALSPQANIT-MRXNPFEDSA-N |
| XLogP | 5.78 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.87 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|