C24H27NO2 — CID 67287923
2-ethyl-3-[3-[[(1R)-1-naphthalen-1-ylethyl]amino]propyl]benzoic acid (PubChem CID 67287923) has the molecular formula C24H27NO2 and a molecular weight of 361.49 g/mol. Its IUPAC name is 2-ethyl-3-[3-[[(1R)-1-naphthalen-1-ylethyl]amino]propyl]benzoic acid.
| Compound Name | 2-ethyl-3-[3-[[(1R)-1-naphthalen-1-ylethyl]amino]propyl]benzoic acid |
|---|---|
| PubChem CID | 67287923 |
| Molecular Formula | C24H27NO2 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | 2-ethyl-3-[3-[[(1R)-1-naphthalen-1-ylethyl]amino]propyl]benzoic acid |
| SMILES | CCc1c(CCCN[C@H](C)c2cccc3ccccc23)cccc1C(=O)O |
| InChI | InChI=1S/C24H27NO2/c1-3-20-18(10-7-15-23(20)24(26)27)12-8-16-25-17(2)21-14-6-11-19-9-4-5-13-22(19)21/h4-7,9-11,13-15,17,25H,3,8,12,16H2,1-2H3,(H,26,27)/t17-/m1/s1 |
| InChIKey | WWUNGRGRUUMMRD-QGZVFWFLSA-N |
| XLogP | 5.38 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|