C18H22N2O3 — CID 87552764
[5-[[(1S)-1-naphthalen-1-ylethyl]amino]-1-oxopentan-2-yl]carbamic acid (PubChem CID 87552764) has the molecular formula C18H22N2O3 and a molecular weight of 314.39 g/mol. Its IUPAC name is [5-[[(1S)-1-naphthalen-1-ylethyl]amino]-1-oxopentan-2-yl]carbamic acid.
| Compound Name | [5-[[(1S)-1-naphthalen-1-ylethyl]amino]-1-oxopentan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 87552764 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | [5-[[(1S)-1-naphthalen-1-ylethyl]amino]-1-oxopentan-2-yl]carbamic acid |
| SMILES | C[C@H](NCCCC(C=O)NC(=O)O)c1cccc2ccccc12 |
| InChI | InChI=1S/C18H22N2O3/c1-13(19-11-5-8-15(12-21)20-18(22)23)16-10-4-7-14-6-2-3-9-17(14)16/h2-4,6-7,9-10,12-13,15,19-20H,5,8,11H2,1H3,(H,22,23)/t13-,15?/m0/s1 |
| InChIKey | IITHZBHYWNSTJP-CFMCSPIPSA-N |
| XLogP | 3.11 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|