C15H18ClN — CID 175208166
3-chloro-N-(1-naphthalen-1-ylethyl)propan-1-amine (PubChem CID 175208166) has the molecular formula C15H18ClN and a molecular weight of 247.77 g/mol. Its IUPAC name is 3-chloro-N-(1-naphthalen-1-ylethyl)propan-1-amine.
| Compound Name | 3-chloro-N-(1-naphthalen-1-ylethyl)propan-1-amine |
|---|---|
| PubChem CID | 175208166 |
| Molecular Formula | C15H18ClN |
| Molecular Weight | 247.77 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | 3-chloro-N-(1-naphthalen-1-ylethyl)propan-1-amine |
| SMILES | CC(NCCCCl)c1cccc2ccccc12 |
| InChI | InChI=1S/C15H18ClN/c1-12(17-11-5-10-16)14-9-4-7-13-6-2-3-8-15(13)14/h2-4,6-9,12,17H,5,10-11H2,1H3 |
| InChIKey | KYCQFVOHIIRTEH-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.77 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|