C22H24FN — CID 71020754
3-[3-(fluoromethyl)phenyl]-N-[(1R)-1-naphthalen-1-ylethyl]propan-1-amine (PubChem CID 71020754) has the molecular formula C22H24FN and a molecular weight of 321.44 g/mol. Its IUPAC name is 3-[3-(fluoromethyl)phenyl]-N-[(1R)-1-naphthalen-1-ylethyl]propan-1-amine.
| Compound Name | 3-[3-(fluoromethyl)phenyl]-N-[(1R)-1-naphthalen-1-ylethyl]propan-1-amine |
|---|---|
| PubChem CID | 71020754 |
| Molecular Formula | C22H24FN |
| Molecular Weight | 321.44 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | 3-[3-(fluoromethyl)phenyl]-N-[(1R)-1-naphthalen-1-ylethyl]propan-1-amine |
| SMILES | C[C@@H](NCCCc1cccc(CF)c1)c1cccc2ccccc12 |
| InChI | InChI=1S/C22H24FN/c1-17(21-13-5-11-20-10-2-3-12-22(20)21)24-14-6-9-18-7-4-8-19(15-18)16-23/h2-5,7-8,10-13,15,17,24H,6,9,14,16H2,1H3/t17-/m1/s1 |
| InChIKey | DNMGSRCUNNXTOJ-QGZVFWFLSA-N |
| XLogP | 5.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.44 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|