C22H22F3N — CID 46241260
N-[(1R)-1-naphthalen-1-ylethyl]-3-[2,3,4,6-tetradeuterio-5-(trifluoromethyl)phenyl]propan-1-amine (PubChem CID 46241260) has the molecular formula C22H22F3N and a molecular weight of 361.44 g/mol. Its IUPAC name is N-[(1R)-1-naphthalen-1-ylethyl]-3-[2,3,4,6-tetradeuterio-5-(trifluoromethyl)phenyl]propan-1-amine.
| Compound Name | N-[(1R)-1-naphthalen-1-ylethyl]-3-[2,3,4,6-tetradeuterio-5-(trifluoromethyl)phenyl]propan-1-amine |
|---|---|
| PubChem CID | 46241260 |
| Molecular Formula | C22H22F3N |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | N-[(1R)-1-naphthalen-1-ylethyl]-3-[2,3,4,6-tetradeuterio-5-(trifluoromethyl)phenyl]propan-1-amine |
| SMILES | [2H]c1c([2H])c(CCCN[C@H](C)c2cccc3ccccc23)c([2H])c(C(F)(F)F)c1[2H] |
| InChI | InChI=1S/C22H22F3N/c1-16(20-13-5-10-18-9-2-3-12-21(18)20)26-14-6-8-17-7-4-11-19(15-17)22(23,24)25/h2-5,7,9-13,15-16,26H,6,8,14H2,1H3/t16-/m1/s1/i4D,7D,11D,15D |
| InChIKey | VDHAWDNDOKGFTD-CLKNOPFHSA-N |
| XLogP | 6.14 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|