C20H18F3N — CID 70834221
(1R)-1-naphthalen-1-yl-N-[[4-(trifluoromethyl)phenyl]methyl]ethanamine (PubChem CID 70834221) has the molecular formula C20H18F3N and a molecular weight of 329.37 g/mol. Its IUPAC name is (1R)-1-naphthalen-1-yl-N-[[4-(trifluoromethyl)phenyl]methyl]ethanamine.
| Compound Name | (1R)-1-naphthalen-1-yl-N-[[4-(trifluoromethyl)phenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 70834221 |
| Molecular Formula | C20H18F3N |
| Molecular Weight | 329.37 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | (1R)-1-naphthalen-1-yl-N-[[4-(trifluoromethyl)phenyl]methyl]ethanamine |
| SMILES | C[C@@H](NCc1ccc(C(F)(F)F)cc1)c1cccc2ccccc12 |
| InChI | InChI=1S/C20H18F3N/c1-14(18-8-4-6-16-5-2-3-7-19(16)18)24-13-15-9-11-17(12-10-15)20(21,22)23/h2-12,14,24H,13H2,1H3/t14-/m1/s1 |
| InChIKey | ICHGYUGWTPIFFQ-CQSZACIVSA-N |
| XLogP | 5.71 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.37 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |