C22H26N2 — CID 70834368
2-[3-[[[(1R)-1-naphthalen-1-ylethyl]amino]methyl]phenyl]propan-2-amine (PubChem CID 70834368) has the molecular formula C22H26N2 and a molecular weight of 318.46 g/mol. Its IUPAC name is 2-[3-[[[(1R)-1-naphthalen-1-ylethyl]amino]methyl]phenyl]propan-2-amine.
| Compound Name | 2-[3-[[[(1R)-1-naphthalen-1-ylethyl]amino]methyl]phenyl]propan-2-amine |
|---|---|
| PubChem CID | 70834368 |
| Molecular Formula | C22H26N2 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.21 |
| IUPAC Name | 2-[3-[[[(1R)-1-naphthalen-1-ylethyl]amino]methyl]phenyl]propan-2-amine |
| SMILES | C[C@@H](NCc1cccc(C(C)(C)N)c1)c1cccc2ccccc12 |
| InChI | InChI=1S/C22H26N2/c1-16(20-13-7-10-18-9-4-5-12-21(18)20)24-15-17-8-6-11-19(14-17)22(2,3)23/h4-14,16,24H,15,23H2,1-3H3/t16-/m1/s1 |
| InChIKey | RJZIXBLVPFCFGF-MRXNPFEDSA-N |
| XLogP | 4.88 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |