C16H15ClF3N — CID 28530583
(1S)-1-(2-chlorophenyl)-N-[[3-(trifluoromethyl)phenyl]methyl]ethanamine (PubChem CID 28530583) has the molecular formula C16H15ClF3N and a molecular weight of 313.75 g/mol. Its IUPAC name is (1S)-1-(2-chlorophenyl)-N-[[3-(trifluoromethyl)phenyl]methyl]ethanamine.
| Compound Name | (1S)-1-(2-chlorophenyl)-N-[[3-(trifluoromethyl)phenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 28530583 |
| Molecular Formula | C16H15ClF3N |
| Molecular Weight | 313.75 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | (1S)-1-(2-chlorophenyl)-N-[[3-(trifluoromethyl)phenyl]methyl]ethanamine |
| SMILES | C[C@H](NCc1cccc(C(F)(F)F)c1)c1ccccc1Cl |
| InChI | InChI=1S/C16H15ClF3N/c1-11(14-7-2-3-8-15(14)17)21-10-12-5-4-6-13(9-12)16(18,19)20/h2-9,11,21H,10H2,1H3/t11-/m0/s1 |
| InChIKey | OMLSNOYYMHKJRF-NSHDSACASA-N |
| XLogP | 5.21 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.75 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |