C24H27F2N — CID 166475844
3-(3,3-difluoro-1,2-dihydroinden-5-yl)-N-[(1R)-1-naphthalen-1-ylethyl]propan-1-amine;molecular hydrogen (PubChem CID 166475844) has the molecular formula C24H27F2N and a molecular weight of 367.48 g/mol. Its IUPAC name is 3-(3,3-difluoro-1,2-dihydroinden-5-yl)-N-[(1R)-1-naphthalen-1-ylethyl]propan-1-amine;molecular hydrogen.
| Compound Name | 3-(3,3-difluoro-1,2-dihydroinden-5-yl)-N-[(1R)-1-naphthalen-1-ylethyl]propan-1-amine;molecular hydrogen |
|---|---|
| PubChem CID | 166475844 |
| Molecular Formula | C24H27F2N |
| Molecular Weight | 367.48 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | 3-(3,3-difluoro-1,2-dihydroinden-5-yl)-N-[(1R)-1-naphthalen-1-ylethyl]propan-1-amine;molecular hydrogen |
| SMILES | C[C@@H](NCCCc1ccc2c(c1)C(F)(F)CC2)c1cccc2ccccc12.[H][H] |
| InChI | InChI=1S/C24H25F2N.H2/c1-17(21-10-4-8-19-7-2-3-9-22(19)21)27-15-5-6-18-11-12-20-13-14-24(25,26)23(20)16-18;/h2-4,7-12,16-17,27H,5-6,13-15H2,1H3;1H/t17-;/m1./s1 |
| InChIKey | FQDFZKFECZHMBF-UNTBIKODSA-N |
| XLogP | 6.41 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.48 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|