C21H24ClN — CID 175678820
N-(1-naphthalen-1-ylethyl)-3-phenylpropan-1-amine;hydrochloride (PubChem CID 175678820) has the molecular formula C21H24ClN and a molecular weight of 325.88 g/mol. Its IUPAC name is N-(1-naphthalen-1-ylethyl)-3-phenylpropan-1-amine;hydrochloride.
| Compound Name | N-(1-naphthalen-1-ylethyl)-3-phenylpropan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 175678820 |
| Molecular Formula | C21H24ClN |
| Molecular Weight | 325.88 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | N-(1-naphthalen-1-ylethyl)-3-phenylpropan-1-amine;hydrochloride |
| SMILES | CC(NCCCc1ccccc1)c1cccc2ccccc12.Cl |
| InChI | InChI=1S/C21H23N.ClH/c1-17(22-16-8-11-18-9-3-2-4-10-18)20-15-7-13-19-12-5-6-14-21(19)20;/h2-7,9-10,12-15,17,22H,8,11,16H2,1H3;1H |
| InChIKey | SAAIOHVJDLNWAB-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.88 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|