C23H26N2O — CID 9397422
2-[[(1S)-1-naphthalen-1-ylethyl]amino]-N-(3-phenylpropyl)acetamide (PubChem CID 9397422) has the molecular formula C23H26N2O and a molecular weight of 346.47 g/mol. Its IUPAC name is 2-[[(1S)-1-naphthalen-1-ylethyl]amino]-N-(3-phenylpropyl)acetamide.
| Compound Name | 2-[[(1S)-1-naphthalen-1-ylethyl]amino]-N-(3-phenylpropyl)acetamide |
|---|---|
| PubChem CID | 9397422 |
| Molecular Formula | C23H26N2O |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | 2-[[(1S)-1-naphthalen-1-ylethyl]amino]-N-(3-phenylpropyl)acetamide |
| SMILES | C[C@H](NCC(=O)NCCCc1ccccc1)c1cccc2ccccc12 |
| InChI | InChI=1S/C23H26N2O/c1-18(21-15-7-13-20-12-5-6-14-22(20)21)25-17-23(26)24-16-8-11-19-9-3-2-4-10-19/h2-7,9-10,12-15,18,25H,8,11,16-17H2,1H3,(H,24,26)/t18-/m0/s1 |
| InChIKey | FNFPVEIXGGALGB-SFHVURJKSA-N |
| XLogP | 4.24 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|