C21H21NO — CID 4807047
2-naphthalen-1-yl-N-(3-phenylpropyl)acetamide (PubChem CID 4807047) has the molecular formula C21H21NO and a molecular weight of 303.41 g/mol. Its IUPAC name is 2-naphthalen-1-yl-N-(3-phenylpropyl)acetamide.
| Compound Name | 2-naphthalen-1-yl-N-(3-phenylpropyl)acetamide |
|---|---|
| PubChem CID | 4807047 |
| Molecular Formula | C21H21NO |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | 2-naphthalen-1-yl-N-(3-phenylpropyl)acetamide |
| SMILES | O=C(Cc1cccc2ccccc12)NCCCc1ccccc1 |
| InChI | InChI=1S/C21H21NO/c23-21(22-15-7-10-17-8-2-1-3-9-17)16-19-13-6-12-18-11-4-5-14-20(18)19/h1-6,8-9,11-14H,7,10,15-16H2,(H,22,23) |
| InChIKey | SRUWHXWYQSFVNY-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|