C18H24N2O — CID 106152740
N-(5-amino-4-methylpentyl)-2-naphthalen-1-ylacetamide (PubChem CID 106152740) has the molecular formula C18H24N2O and a molecular weight of 284.40 g/mol. Its IUPAC name is N-(5-amino-4-methylpentyl)-2-naphthalen-1-ylacetamide.
| Compound Name | N-(5-amino-4-methylpentyl)-2-naphthalen-1-ylacetamide |
|---|---|
| PubChem CID | 106152740 |
| Molecular Formula | C18H24N2O |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | N-(5-amino-4-methylpentyl)-2-naphthalen-1-ylacetamide |
| SMILES | CC(CN)CCCNC(=O)Cc1cccc2ccccc12 |
| InChI | InChI=1S/C18H24N2O/c1-14(13-19)6-5-11-20-18(21)12-16-9-4-8-15-7-2-3-10-17(15)16/h2-4,7-10,14H,5-6,11-13,19H2,1H3,(H,20,21) |
| InChIKey | UJSMMEKNMFXWOL-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|