C18H24ClN3O2 — CID 119497414
N-[2-(3-aminobutylamino)-2-oxoethyl]-2-naphthalen-1-ylacetamide;hydrochloride (PubChem CID 119497414) has the molecular formula C18H24ClN3O2 and a molecular weight of 349.86 g/mol. Its IUPAC name is N-[2-(3-aminobutylamino)-2-oxoethyl]-2-naphthalen-1-ylacetamide;hydrochloride.
| Compound Name | N-[2-(3-aminobutylamino)-2-oxoethyl]-2-naphthalen-1-ylacetamide;hydrochloride |
|---|---|
| PubChem CID | 119497414 |
| Molecular Formula | C18H24ClN3O2 |
| Molecular Weight | 349.86 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | N-[2-(3-aminobutylamino)-2-oxoethyl]-2-naphthalen-1-ylacetamide;hydrochloride |
| SMILES | CC(N)CCNC(=O)CNC(=O)Cc1cccc2ccccc12.Cl |
| InChI | InChI=1S/C18H23N3O2.ClH/c1-13(19)9-10-20-18(23)12-21-17(22)11-15-7-4-6-14-5-2-3-8-16(14)15;/h2-8,13H,9-12,19H2,1H3,(H,20,23)(H,21,22);1H |
| InChIKey | HNPRNGWJEWYALJ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.86 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |