C21H23Cl2NO — CID 71723808
3-(2-chlorophenoxy)-N-[(1R)-1-naphthalen-1-ylethyl]propan-1-amine;hydrochloride (PubChem CID 71723808) has the molecular formula C21H23Cl2NO and a molecular weight of 376.33 g/mol. Its IUPAC name is 3-(2-chlorophenoxy)-N-[(1R)-1-naphthalen-1-ylethyl]propan-1-amine;hydrochloride.
| Compound Name | 3-(2-chlorophenoxy)-N-[(1R)-1-naphthalen-1-ylethyl]propan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 71723808 |
| Molecular Formula | C21H23Cl2NO |
| Molecular Weight | 376.33 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | 3-(2-chlorophenoxy)-N-[(1R)-1-naphthalen-1-ylethyl]propan-1-amine;hydrochloride |
| SMILES | C[C@@H](NCCCOc1ccccc1Cl)c1cccc2ccccc12.Cl |
| InChI | InChI=1S/C21H22ClNO.ClH/c1-16(18-11-6-9-17-8-2-3-10-19(17)18)23-14-7-15-24-21-13-5-4-12-20(21)22;/h2-6,8-13,16,23H,7,14-15H2,1H3;1H/t16-;/m1./s1 |
| InChIKey | PQUYVYUNGDLVSF-PKLMIRHRSA-N |
| XLogP | 6.03 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.33 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|