C21H31N — CID 130392686
3-ethyl-N-(1-naphthalen-1-ylethyl)heptan-1-amine (PubChem CID 130392686) has the molecular formula C21H31N and a molecular weight of 297.49 g/mol. Its IUPAC name is 3-ethyl-N-(1-naphthalen-1-ylethyl)heptan-1-amine.
| Compound Name | 3-ethyl-N-(1-naphthalen-1-ylethyl)heptan-1-amine |
|---|---|
| PubChem CID | 130392686 |
| Molecular Formula | C21H31N |
| Molecular Weight | 297.49 g/mol |
| Exact Mass | 297.25 |
| IUPAC Name | 3-ethyl-N-(1-naphthalen-1-ylethyl)heptan-1-amine |
| SMILES | CCCCC(CC)CCNC(C)c1cccc2ccccc12 |
| InChI | InChI=1S/C21H31N/c1-4-6-10-18(5-2)15-16-22-17(3)20-14-9-12-19-11-7-8-13-21(19)20/h7-9,11-14,17-18,22H,4-6,10,15-16H2,1-3H3 |
| InChIKey | IQYMSKYNMXHLBN-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.49 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |