C26H24N2O2 — CID 90809930
N'-(1-naphthalen-1-ylethyl)-N-[(1S)-1-naphthalen-1-ylethyl]oxamide (PubChem CID 90809930) has the molecular formula C26H24N2O2 and a molecular weight of 396.49 g/mol. Its IUPAC name is N'-(1-naphthalen-1-ylethyl)-N-[(1S)-1-naphthalen-1-ylethyl]oxamide.
| Compound Name | N'-(1-naphthalen-1-ylethyl)-N-[(1S)-1-naphthalen-1-ylethyl]oxamide |
|---|---|
| PubChem CID | 90809930 |
| Molecular Formula | C26H24N2O2 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | N'-(1-naphthalen-1-ylethyl)-N-[(1S)-1-naphthalen-1-ylethyl]oxamide |
| SMILES | CC(NC(=O)C(=O)N[C@@H](C)c1cccc2ccccc12)c1cccc2ccccc12 |
| InChI | InChI=1S/C26H24N2O2/c1-17(21-15-7-11-19-9-3-5-13-23(19)21)27-25(29)26(30)28-18(2)22-16-8-12-20-10-4-6-14-24(20)22/h3-18H,1-2H3,(H,27,29)(H,28,30)/t17-,18?/m0/s1 |
| InChIKey | KMNUNKRWTDSYQZ-ZENAZSQFSA-N |
| XLogP | 5.05 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|