C16H17NO2 — CID 70562068
3-[[(1S)-1-naphthalen-1-ylethyl]amino]but-2-enoic acid (PubChem CID 70562068) has the molecular formula C16H17NO2 and a molecular weight of 255.32 g/mol. Its IUPAC name is 3-[[(1S)-1-naphthalen-1-ylethyl]amino]but-2-enoic acid.
| Compound Name | 3-[[(1S)-1-naphthalen-1-ylethyl]amino]but-2-enoic acid |
|---|---|
| PubChem CID | 70562068 |
| Molecular Formula | C16H17NO2 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | 3-[[(1S)-1-naphthalen-1-ylethyl]amino]but-2-enoic acid |
| SMILES | CC(=CC(=O)O)N[C@@H](C)c1cccc2ccccc12 |
| InChI | InChI=1S/C16H17NO2/c1-11(10-16(18)19)17-12(2)14-9-5-7-13-6-3-4-8-15(13)14/h3-10,12,17H,1-2H3,(H,18,19)/t12-/m0/s1 |
| InChIKey | ITXFNYWDPVLVET-LBPRGKRZSA-N |
| XLogP | 3.48 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|