C22H24Cl3NO2 — CID 70564010
(1,1,1-trichloro-4-methylpent-3-en-2-yl) (Z)-3-(1-naphthalen-1-ylethylamino)but-2-enoate (PubChem CID 70564010) has the molecular formula C22H24Cl3NO2 and a molecular weight of 440.80 g/mol. Its IUPAC name is (1,1,1-trichloro-4-methylpent-3-en-2-yl) (Z)-3-(1-naphthalen-1-ylethylamino)but-2-enoate.
| Compound Name | (1,1,1-trichloro-4-methylpent-3-en-2-yl) (Z)-3-(1-naphthalen-1-ylethylamino)but-2-enoate |
|---|---|
| PubChem CID | 70564010 |
| Molecular Formula | C22H24Cl3NO2 |
| Molecular Weight | 440.80 g/mol |
| Exact Mass | 439.09 |
| IUPAC Name | (1,1,1-trichloro-4-methylpent-3-en-2-yl) (Z)-3-(1-naphthalen-1-ylethylamino)but-2-enoate |
| SMILES | CC(C)=CC(OC(=O)/C=C(/C)NC(C)c1cccc2ccccc12)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C22H24Cl3NO2/c1-14(2)12-20(22(23,24)25)28-21(27)13-15(3)26-16(4)18-11-7-9-17-8-5-6-10-19(17)18/h5-13,16,20,26H,1-4H3/b15-13- |
| InChIKey | NASIBOARWHLLAS-SQFISAMPSA-N |
| XLogP | 6.64 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.80 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|