C17H20Cl3NO3 — CID 101131870
(1,1,1-trichloro-4-methylpent-3-en-2-yl) 3-oxo-3-[[(1R)-1-phenylethyl]amino]propanoate (PubChem CID 101131870) has the molecular formula C17H20Cl3NO3 and a molecular weight of 392.71 g/mol. Its IUPAC name is (1,1,1-trichloro-4-methylpent-3-en-2-yl) 3-oxo-3-[[(1R)-1-phenylethyl]amino]propanoate.
| Compound Name | (1,1,1-trichloro-4-methylpent-3-en-2-yl) 3-oxo-3-[[(1R)-1-phenylethyl]amino]propanoate |
|---|---|
| PubChem CID | 101131870 |
| Molecular Formula | C17H20Cl3NO3 |
| Molecular Weight | 392.71 g/mol |
| Exact Mass | 391.05 |
| IUPAC Name | (1,1,1-trichloro-4-methylpent-3-en-2-yl) 3-oxo-3-[[(1R)-1-phenylethyl]amino]propanoate |
| SMILES | CC(C)=CC(OC(=O)CC(=O)N[C@H](C)c1ccccc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C17H20Cl3NO3/c1-11(2)9-14(17(18,19)20)24-16(23)10-15(22)21-12(3)13-7-5-4-6-8-13/h4-9,12,14H,10H2,1-3H3,(H,21,22)/t12-,14?/m1/s1 |
| InChIKey | QBCKVPSJCWZTHO-PUODRLBUSA-N |
| XLogP | 4.50 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.71 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|