C12H14Cl3NO2 — CID 2412800
(3S)-4,4,4-trichloro-3-hydroxy-N-[(1R)-1-phenylethyl]butanamide (PubChem CID 2412800) has the molecular formula C12H14Cl3NO2 and a molecular weight of 310.61 g/mol. Its IUPAC name is (3S)-4,4,4-trichloro-3-hydroxy-N-[(1R)-1-phenylethyl]butanamide.
| Compound Name | (3S)-4,4,4-trichloro-3-hydroxy-N-[(1R)-1-phenylethyl]butanamide |
|---|---|
| PubChem CID | 2412800 |
| Molecular Formula | C12H14Cl3NO2 |
| Molecular Weight | 310.61 g/mol |
| Exact Mass | 309.01 |
| IUPAC Name | (3S)-4,4,4-trichloro-3-hydroxy-N-[(1R)-1-phenylethyl]butanamide |
| SMILES | C[C@@H](NC(=O)C[C@H](O)C(Cl)(Cl)Cl)c1ccccc1 |
| InChI | InChI=1S/C12H14Cl3NO2/c1-8(9-5-3-2-4-6-9)16-11(18)7-10(17)12(13,14)15/h2-6,8,10,17H,7H2,1H3,(H,16,18)/t8-,10+/m1/s1 |
| InChIKey | MUVSFWXBIPPSHV-SCZZXKLOSA-N |
| XLogP | 2.98 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.61 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|