C21H26N2O2 — CID 42563153
(2R)-2-methyl-N,N'-bis[(1R)-1-phenylethyl]butanediamide (PubChem CID 42563153) has the molecular formula C21H26N2O2 and a molecular weight of 338.45 g/mol. Its IUPAC name is (2R)-2-methyl-N,N'-bis[(1R)-1-phenylethyl]butanediamide.
| Compound Name | (2R)-2-methyl-N,N'-bis[(1R)-1-phenylethyl]butanediamide |
|---|---|
| PubChem CID | 42563153 |
| Molecular Formula | C21H26N2O2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | (2R)-2-methyl-N,N'-bis[(1R)-1-phenylethyl]butanediamide |
| SMILES | C[C@H](CC(=O)N[C@H](C)c1ccccc1)C(=O)N[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C21H26N2O2/c1-15(21(25)23-17(3)19-12-8-5-9-13-19)14-20(24)22-16(2)18-10-6-4-7-11-18/h4-13,15-17H,14H2,1-3H3,(H,22,24)(H,23,25)/t15-,16-,17-/m1/s1 |
| InChIKey | JNDAQUMQXJWVKQ-BRWVUGGUSA-N |
| XLogP | 3.77 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |