C15H25NOSi — CID 101207602
N-(1-phenylethyl)-3-trimethylsilylbutanamide (PubChem CID 101207602) has the molecular formula C15H25NOSi and a molecular weight of 263.46 g/mol. Its IUPAC name is N-(1-phenylethyl)-3-trimethylsilylbutanamide.
| Compound Name | N-(1-phenylethyl)-3-trimethylsilylbutanamide |
|---|---|
| PubChem CID | 101207602 |
| Molecular Formula | C15H25NOSi |
| Molecular Weight | 263.46 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | N-(1-phenylethyl)-3-trimethylsilylbutanamide |
| SMILES | CC(NC(=O)CC(C)[Si](C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C15H25NOSi/c1-12(18(3,4)5)11-15(17)16-13(2)14-9-7-6-8-10-14/h6-10,12-13H,11H2,1-5H3,(H,16,17) |
| InChIKey | WKEBRKMLJYOKPU-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.46 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|