C25H27NO — CID 17326867
N-[1-(4-ethylphenyl)ethyl]-3,3-diphenylpropanamide (PubChem CID 17326867) has the molecular formula C25H27NO and a molecular weight of 357.50 g/mol. Its IUPAC name is N-[1-(4-ethylphenyl)ethyl]-3,3-diphenylpropanamide.
| Compound Name | N-[1-(4-ethylphenyl)ethyl]-3,3-diphenylpropanamide |
|---|---|
| PubChem CID | 17326867 |
| Molecular Formula | C25H27NO |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | N-[1-(4-ethylphenyl)ethyl]-3,3-diphenylpropanamide |
| SMILES | CCc1ccc(C(C)NC(=O)CC(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H27NO/c1-3-20-14-16-21(17-15-20)19(2)26-25(27)18-24(22-10-6-4-7-11-22)23-12-8-5-9-13-23/h4-17,19,24H,3,18H2,1-2H3,(H,26,27) |
| InChIKey | VZHZHLGQPMQDLV-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |