C17H20ClN — CID 95168121
3-(2-chlorophenyl)-N-[(1R)-1-phenylethyl]propan-1-amine (PubChem CID 95168121) has the molecular formula C17H20ClN and a molecular weight of 273.81 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-N-[(1R)-1-phenylethyl]propan-1-amine.
| Compound Name | 3-(2-chlorophenyl)-N-[(1R)-1-phenylethyl]propan-1-amine |
|---|---|
| PubChem CID | 95168121 |
| Molecular Formula | C17H20ClN |
| Molecular Weight | 273.81 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | 3-(2-chlorophenyl)-N-[(1R)-1-phenylethyl]propan-1-amine |
| SMILES | C[C@@H](NCCCc1ccccc1Cl)c1ccccc1 |
| InChI | InChI=1S/C17H20ClN/c1-14(15-8-3-2-4-9-15)19-13-7-11-16-10-5-6-12-17(16)18/h2-6,8-10,12,14,19H,7,11,13H2,1H3/t14-/m1/s1 |
| InChIKey | WDMUAHNIKXPANJ-CQSZACIVSA-N |
| XLogP | 4.62 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.81 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|