C26H25NO2S — CID 101480064
[2-[2-[[[(1R)-1-naphthalen-1-ylethyl]amino]methyl]phenyl]sulfinylphenyl]methanol (PubChem CID 101480064) has the molecular formula C26H25NO2S and a molecular weight of 415.56 g/mol. Its IUPAC name is [2-[2-[[[(1R)-1-naphthalen-1-ylethyl]amino]methyl]phenyl]sulfinylphenyl]methanol.
| Compound Name | [2-[2-[[[(1R)-1-naphthalen-1-ylethyl]amino]methyl]phenyl]sulfinylphenyl]methanol |
|---|---|
| PubChem CID | 101480064 |
| Molecular Formula | C26H25NO2S |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | [2-[2-[[[(1R)-1-naphthalen-1-ylethyl]amino]methyl]phenyl]sulfinylphenyl]methanol |
| SMILES | C[C@@H](NCc1ccccc1S(=O)c1ccccc1CO)c1cccc2ccccc12 |
| InChI | InChI=1S/C26H25NO2S/c1-19(23-14-8-12-20-9-2-5-13-24(20)23)27-17-21-10-3-6-15-25(21)30(29)26-16-7-4-11-22(26)18-28/h2-16,19,27-28H,17-18H2,1H3/t19-,30?/m1/s1 |
| InChIKey | AMYFYDWWDWUQMZ-HZRSZRRBSA-N |
| XLogP | 5.35 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |