C20H20FN — CID 143626004
N-[(2-fluoro-5-methylphenyl)methyl]-1-naphthalen-1-ylethanamine (PubChem CID 143626004) has the molecular formula C20H20FN and a molecular weight of 293.39 g/mol. Its IUPAC name is N-[(2-fluoro-5-methylphenyl)methyl]-1-naphthalen-1-ylethanamine.
| Compound Name | N-[(2-fluoro-5-methylphenyl)methyl]-1-naphthalen-1-ylethanamine |
|---|---|
| PubChem CID | 143626004 |
| Molecular Formula | C20H20FN |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | N-[(2-fluoro-5-methylphenyl)methyl]-1-naphthalen-1-ylethanamine |
| SMILES | Cc1ccc(F)c(CNC(C)c2cccc3ccccc23)c1 |
| InChI | InChI=1S/C20H20FN/c1-14-10-11-20(21)17(12-14)13-22-15(2)18-9-5-7-16-6-3-4-8-19(16)18/h3-12,15,22H,13H2,1-2H3 |
| InChIKey | FTFUYZYBYVRSKE-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |