C14H17NO4S — CID 104520929
N-[[3-(3-hydroxyprop-1-ynyl)phenyl]methyl]-2-methylsulfonylpropanamide (PubChem CID 104520929) has the molecular formula C14H17NO4S and a molecular weight of 295.36 g/mol. Its IUPAC name is N-[[3-(3-hydroxyprop-1-ynyl)phenyl]methyl]-2-methylsulfonylpropanamide.
| Compound Name | N-[[3-(3-hydroxyprop-1-ynyl)phenyl]methyl]-2-methylsulfonylpropanamide |
|---|---|
| PubChem CID | 104520929 |
| Molecular Formula | C14H17NO4S |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | N-[[3-(3-hydroxyprop-1-ynyl)phenyl]methyl]-2-methylsulfonylpropanamide |
| SMILES | CC(C(=O)NCc1cccc(C#CCO)c1)S(C)(=O)=O |
| InChI | InChI=1S/C14H17NO4S/c1-11(20(2,18)19)14(17)15-10-13-6-3-5-12(9-13)7-4-8-16/h3,5-6,9,11,16H,8,10H2,1-2H3,(H,15,17) |
| InChIKey | RHBPBEHBIRFEGW-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|