C12H15NO4S2 — CID 104520948
N-[[4-(3-hydroxyprop-1-ynyl)thiophen-2-yl]methyl]-2-methylsulfonylpropanamide (PubChem CID 104520948) has the molecular formula C12H15NO4S2 and a molecular weight of 301.39 g/mol. Its IUPAC name is N-[[4-(3-hydroxyprop-1-ynyl)thiophen-2-yl]methyl]-2-methylsulfonylpropanamide.
| Compound Name | N-[[4-(3-hydroxyprop-1-ynyl)thiophen-2-yl]methyl]-2-methylsulfonylpropanamide |
|---|---|
| PubChem CID | 104520948 |
| Molecular Formula | C12H15NO4S2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.04 |
| IUPAC Name | N-[[4-(3-hydroxyprop-1-ynyl)thiophen-2-yl]methyl]-2-methylsulfonylpropanamide |
| SMILES | CC(C(=O)NCc1cc(C#CCO)cs1)S(C)(=O)=O |
| InChI | InChI=1S/C12H15NO4S2/c1-9(19(2,16)17)12(15)13-7-11-6-10(8-18-11)4-3-5-14/h6,8-9,14H,5,7H2,1-2H3,(H,13,15) |
| InChIKey | DVWDCNAXCNAYQH-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|