C11H16N2O4S2 — CID 114816456
3-[5-[(2-methoxyethylsulfamoylamino)methyl]thiophen-3-yl]prop-2-yn-1-ol (PubChem CID 114816456) has the molecular formula C11H16N2O4S2 and a molecular weight of 304.39 g/mol. Its IUPAC name is 3-[5-[(2-methoxyethylsulfamoylamino)methyl]thiophen-3-yl]prop-2-yn-1-ol.
| Compound Name | 3-[5-[(2-methoxyethylsulfamoylamino)methyl]thiophen-3-yl]prop-2-yn-1-ol |
|---|---|
| PubChem CID | 114816456 |
| Molecular Formula | C11H16N2O4S2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 3-[5-[(2-methoxyethylsulfamoylamino)methyl]thiophen-3-yl]prop-2-yn-1-ol |
| SMILES | COCCNS(=O)(=O)NCc1cc(C#CCO)cs1 |
| InChI | InChI=1S/C11H16N2O4S2/c1-17-6-4-12-19(15,16)13-8-11-7-10(9-18-11)3-2-5-14/h7,9,12-14H,4-6,8H2,1H3 |
| InChIKey | DRRSMCQXPBXUDR-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|