C12H16N2O5S2 — CID 114465712
ethyl N-[[4-(3-hydroxyprop-1-ynyl)thiophen-2-yl]methyl-methylsulfamoyl]carbamate (PubChem CID 114465712) has the molecular formula C12H16N2O5S2 and a molecular weight of 332.40 g/mol. Its IUPAC name is ethyl N-[[4-(3-hydroxyprop-1-ynyl)thiophen-2-yl]methyl-methylsulfamoyl]carbamate.
| Compound Name | ethyl N-[[4-(3-hydroxyprop-1-ynyl)thiophen-2-yl]methyl-methylsulfamoyl]carbamate |
|---|---|
| PubChem CID | 114465712 |
| Molecular Formula | C12H16N2O5S2 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | ethyl N-[[4-(3-hydroxyprop-1-ynyl)thiophen-2-yl]methyl-methylsulfamoyl]carbamate |
| SMILES | CCOC(=O)NS(=O)(=O)N(C)Cc1cc(C#CCO)cs1 |
| InChI | InChI=1S/C12H16N2O5S2/c1-3-19-12(16)13-21(17,18)14(2)8-11-7-10(9-20-11)5-4-6-15/h7,9,15H,3,6,8H2,1-2H3,(H,13,16) |
| InChIKey | PDFRKKZHWFXARS-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|