C13H14F3NO3S — CID 103209897
N-[[4-(3-hydroxyprop-1-ynyl)thiophen-2-yl]methyl]-N-methyl-2-(2,2,2-trifluoroethoxy)acetamide (PubChem CID 103209897) has the molecular formula C13H14F3NO3S and a molecular weight of 321.32 g/mol. Its IUPAC name is N-[[4-(3-hydroxyprop-1-ynyl)thiophen-2-yl]methyl]-N-methyl-2-(2,2,2-trifluoroethoxy)acetamide.
| Compound Name | N-[[4-(3-hydroxyprop-1-ynyl)thiophen-2-yl]methyl]-N-methyl-2-(2,2,2-trifluoroethoxy)acetamide |
|---|---|
| PubChem CID | 103209897 |
| Molecular Formula | C13H14F3NO3S |
| Molecular Weight | 321.32 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | N-[[4-(3-hydroxyprop-1-ynyl)thiophen-2-yl]methyl]-N-methyl-2-(2,2,2-trifluoroethoxy)acetamide |
| SMILES | CN(Cc1cc(C#CCO)cs1)C(=O)COCC(F)(F)F |
| InChI | InChI=1S/C13H14F3NO3S/c1-17(12(19)7-20-9-13(14,15)16)6-11-5-10(8-21-11)3-2-4-18/h5,8,18H,4,6-7,9H2,1H3 |
| InChIKey | LWJGTSCVVLQONE-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.32 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|