C13H15N3O2S3 — CID 103415589
N-[[4-(3-aminoprop-1-ynyl)thiophen-2-yl]methyl]-N,2-dimethyl-1,3-thiazole-5-sulfonamide (PubChem CID 103415589) has the molecular formula C13H15N3O2S3 and a molecular weight of 341.48 g/mol. Its IUPAC name is N-[[4-(3-aminoprop-1-ynyl)thiophen-2-yl]methyl]-N,2-dimethyl-1,3-thiazole-5-sulfonamide.
| Compound Name | N-[[4-(3-aminoprop-1-ynyl)thiophen-2-yl]methyl]-N,2-dimethyl-1,3-thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 103415589 |
| Molecular Formula | C13H15N3O2S3 |
| Molecular Weight | 341.48 g/mol |
| Exact Mass | 341.03 |
| IUPAC Name | N-[[4-(3-aminoprop-1-ynyl)thiophen-2-yl]methyl]-N,2-dimethyl-1,3-thiazole-5-sulfonamide |
| SMILES | Cc1ncc(S(=O)(=O)N(C)Cc2cc(C#CCN)cs2)s1 |
| InChI | InChI=1S/C13H15N3O2S3/c1-10-15-7-13(20-10)21(17,18)16(2)8-12-6-11(9-19-12)4-3-5-14/h6-7,9H,5,8,14H2,1-2H3 |
| InChIKey | RNNWNYYVOAOFHD-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.48 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|