C12H18N2O2S2 — CID 79850307
3-[5-[[methyl(2-methylsulfonylethyl)amino]methyl]thiophen-3-yl]prop-2-yn-1-amine (PubChem CID 79850307) has the molecular formula C12H18N2O2S2 and a molecular weight of 286.42 g/mol. Its IUPAC name is 3-[5-[[methyl(2-methylsulfonylethyl)amino]methyl]thiophen-3-yl]prop-2-yn-1-amine.
| Compound Name | 3-[5-[[methyl(2-methylsulfonylethyl)amino]methyl]thiophen-3-yl]prop-2-yn-1-amine |
|---|---|
| PubChem CID | 79850307 |
| Molecular Formula | C12H18N2O2S2 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 3-[5-[[methyl(2-methylsulfonylethyl)amino]methyl]thiophen-3-yl]prop-2-yn-1-amine |
| SMILES | CN(CCS(C)(=O)=O)Cc1cc(C#CCN)cs1 |
| InChI | InChI=1S/C12H18N2O2S2/c1-14(6-7-18(2,15)16)9-12-8-11(10-17-12)4-3-5-13/h8,10H,5-7,9,13H2,1-2H3 |
| InChIKey | SVJXHNCHWMNKFL-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|