C12H15NO5S2 — CID 82842076
N-[[3-(3-hydroxyprop-1-ynyl)phenyl]methyl]-1-methylsulfonylmethanesulfonamide (PubChem CID 82842076) has the molecular formula C12H15NO5S2 and a molecular weight of 317.39 g/mol. Its IUPAC name is N-[[3-(3-hydroxyprop-1-ynyl)phenyl]methyl]-1-methylsulfonylmethanesulfonamide.
| Compound Name | N-[[3-(3-hydroxyprop-1-ynyl)phenyl]methyl]-1-methylsulfonylmethanesulfonamide |
|---|---|
| PubChem CID | 82842076 |
| Molecular Formula | C12H15NO5S2 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | N-[[3-(3-hydroxyprop-1-ynyl)phenyl]methyl]-1-methylsulfonylmethanesulfonamide |
| SMILES | CS(=O)(=O)CS(=O)(=O)NCc1cccc(C#CCO)c1 |
| InChI | InChI=1S/C12H15NO5S2/c1-19(15,16)10-20(17,18)13-9-12-5-2-4-11(8-12)6-3-7-14/h2,4-5,8,13-14H,7,9-10H2,1H3 |
| InChIKey | XSKFLCNPBRQGQD-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|