C11H14N2O3S — CID 114811666
3-[3-(ethylsulfamoylamino)phenyl]prop-2-yn-1-ol (PubChem CID 114811666) has the molecular formula C11H14N2O3S and a molecular weight of 254.31 g/mol. Its IUPAC name is 3-[3-(ethylsulfamoylamino)phenyl]prop-2-yn-1-ol.
| Compound Name | 3-[3-(ethylsulfamoylamino)phenyl]prop-2-yn-1-ol |
|---|---|
| PubChem CID | 114811666 |
| Molecular Formula | C11H14N2O3S |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | 3-[3-(ethylsulfamoylamino)phenyl]prop-2-yn-1-ol |
| SMILES | CCNS(=O)(=O)Nc1cccc(C#CCO)c1 |
| InChI | InChI=1S/C11H14N2O3S/c1-2-12-17(15,16)13-11-7-3-5-10(9-11)6-4-8-14/h3,5,7,9,12-14H,2,8H2,1H3 |
| InChIKey | GBXFBFGYAHBPKN-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|