C12H13NO5S — CID 61456773
methyl 2-[[3-(3-hydroxyprop-1-ynyl)phenyl]sulfamoyl]acetate (PubChem CID 61456773) has the molecular formula C12H13NO5S and a molecular weight of 283.31 g/mol. Its IUPAC name is methyl 2-[[3-(3-hydroxyprop-1-ynyl)phenyl]sulfamoyl]acetate.
| Compound Name | methyl 2-[[3-(3-hydroxyprop-1-ynyl)phenyl]sulfamoyl]acetate |
|---|---|
| PubChem CID | 61456773 |
| Molecular Formula | C12H13NO5S |
| Molecular Weight | 283.31 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | methyl 2-[[3-(3-hydroxyprop-1-ynyl)phenyl]sulfamoyl]acetate |
| SMILES | COC(=O)CS(=O)(=O)Nc1cccc(C#CCO)c1 |
| InChI | InChI=1S/C12H13NO5S/c1-18-12(15)9-19(16,17)13-11-6-2-4-10(8-11)5-3-7-14/h2,4,6,8,13-14H,7,9H2,1H3 |
| InChIKey | FJOUCJCXKBSOIW-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.31 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|