C14H17NO5S — CID 107579194
methyl 2-[[3-(4-hydroxybut-1-ynyl)-5-methylphenyl]sulfamoyl]acetate (PubChem CID 107579194) has the molecular formula C14H17NO5S and a molecular weight of 311.36 g/mol. Its IUPAC name is methyl 2-[[3-(4-hydroxybut-1-ynyl)-5-methylphenyl]sulfamoyl]acetate.
| Compound Name | methyl 2-[[3-(4-hydroxybut-1-ynyl)-5-methylphenyl]sulfamoyl]acetate |
|---|---|
| PubChem CID | 107579194 |
| Molecular Formula | C14H17NO5S |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | methyl 2-[[3-(4-hydroxybut-1-ynyl)-5-methylphenyl]sulfamoyl]acetate |
| SMILES | COC(=O)CS(=O)(=O)Nc1cc(C)cc(C#CCCO)c1 |
| InChI | InChI=1S/C14H17NO5S/c1-11-7-12(5-3-4-6-16)9-13(8-11)15-21(18,19)10-14(17)20-2/h7-9,15-16H,4,6,10H2,1-2H3 |
| InChIKey | LNFAHNYOXGSULO-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|