C16H19NO4 — CID 115999883
methyl 2-[[3-(4-hydroxybut-1-ynyl)-5-methylbenzoyl]-methylamino]acetate (PubChem CID 115999883) has the molecular formula C16H19NO4 and a molecular weight of 289.33 g/mol. Its IUPAC name is methyl 2-[[3-(4-hydroxybut-1-ynyl)-5-methylbenzoyl]-methylamino]acetate.
| Compound Name | methyl 2-[[3-(4-hydroxybut-1-ynyl)-5-methylbenzoyl]-methylamino]acetate |
|---|---|
| PubChem CID | 115999883 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | methyl 2-[[3-(4-hydroxybut-1-ynyl)-5-methylbenzoyl]-methylamino]acetate |
| SMILES | COC(=O)CN(C)C(=O)c1cc(C)cc(C#CCCO)c1 |
| InChI | InChI=1S/C16H19NO4/c1-12-8-13(6-4-5-7-18)10-14(9-12)16(20)17(2)11-15(19)21-3/h8-10,18H,5,7,11H2,1-3H3 |
| InChIKey | XKZPBYHQRGZHBU-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|