C12H14O — CID 60918613
4-(3,5-dimethylphenyl)but-3-yn-1-ol (PubChem CID 60918613) has the molecular formula C12H14O and a molecular weight of 174.24 g/mol. Its IUPAC name is 4-(3,5-dimethylphenyl)but-3-yn-1-ol.
| Compound Name | 4-(3,5-dimethylphenyl)but-3-yn-1-ol |
|---|---|
| PubChem CID | 60918613 |
| Molecular Formula | C12H14O |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | 4-(3,5-dimethylphenyl)but-3-yn-1-ol |
| SMILES | Cc1cc(C)cc(C#CCCO)c1 |
| InChI | InChI=1S/C12H14O/c1-10-7-11(2)9-12(8-10)5-3-4-6-13/h7-9,13H,4,6H2,1-2H3 |
| InChIKey | BKOIRRWVIRLCNB-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|